(4R,5R)-4,5-dihydroxycyclohexene-1-carboxylic acid

C7H10O4 — CID 5288062

IUPAC(4R,5R)-4,5-dihydroxycyclohexene-1-carboxylic acid
SMILESO=C(O)C1=CC[C@@H](O)[C@H](O)C1
InChIInChI=1S/C7H10O4/c8-5-2-1-4(7(10)11)3-6(5)9/h1,5-6,8-9H,2-3H2,(H,10,11)/t5-,6-/m1/s1
InChIKeyZJFDZKAGRTZFDZ-PHDIDXHHSA-N
MW158.15 g/mol
LogP-0.49
Rot. Bonds1

About (4R,5R)-4,5-dihydroxycyclohexene-1-carboxylic acid

(4R,5R)-4,5-dihydroxycyclohexene-1-carboxylic acid (PubChem CID 5288062) has the molecular formula C7H10O4 and a molecular weight of 158.15 g/mol. Its IUPAC name is (4R,5R)-4,5-dihydroxycyclohexene-1-carboxylic acid.

Molecular Properties

Compound Name(4R,5R)-4,5-dihydroxycyclohexene-1-carboxylic acid
PubChem CID5288062
Molecular FormulaC7H10O4
Molecular Weight158.15 g/mol
Exact Mass158.06
IUPAC Name(4R,5R)-4,5-dihydroxycyclohexene-1-carboxylic acid
SMILESO=C(O)C1=CC[C@@H](O)[C@H](O)C1
InChIInChI=1S/C7H10O4/c8-5-2-1-4(7(10)11)3-6(5)9/h1,5-6,8-9H,2-3H2,(H,10,11)/t5-,6-/m1/s1
InChIKeyZJFDZKAGRTZFDZ-PHDIDXHHSA-N
XLogP-0.49
TPSA77.76 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500158.15
LogP ≤ 5-0.49
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze (4R,5R)-4,5-dihydroxycyclohexene-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (4R,5R)-4,5-dihydroxycyclohexene-1-carboxylic acid?
The IUPAC name of (4R,5R)-4,5-dihydroxycyclohexene-1-carboxylic acid (CID 5288062) is (4R,5R)-4,5-dihydroxycyclohexene-1-carboxylic acid.
What is the SMILES notation for (4R,5R)-4,5-dihydroxycyclohexene-1-carboxylic acid?
The canonical SMILES for (4R,5R)-4,5-dihydroxycyclohexene-1-carboxylic acid is O=C(O)C1=CC[C@@H](O)[C@H](O)C1.
What is the InChIKey of (4R,5R)-4,5-dihydroxycyclohexene-1-carboxylic acid?
The InChIKey is ZJFDZKAGRTZFDZ-PHDIDXHHSA-N. The full InChI is InChI=1S/C7H10O4/c8-5-2-1-4(7(10)11)3-6(5)9/h1,5-6,8-9H,2-3H2,(H,10,11)/t5-,6-/m1/s1.
What are the key properties of (4R,5R)-4,5-dihydroxycyclohexene-1-carboxylic acid?
(4R,5R)-4,5-dihydroxycyclohexene-1-carboxylic acid has a molecular weight of 158.15 g/mol, XLogP of -0.49, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4R,5R)-4,5-dihydroxycyclohexene-1-carboxylic acid is sourced from PubChem (CID 5288062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).