C27H41N5O14 — CID 5288155
5-(azidomethyl)-1-N,3-N-bis[3-[(2S,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl]benzene-1,3-dicarboxamide (PubChem CID 5288155) has the molecular formula C27H41N5O14 and a molecular weight of 659.65 g/mol. Its IUPAC name is 5-(azidomethyl)-1-N,3-N-bis[3-[(2S,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl]benzene-1,3-dicarboxamide.
| Compound Name | 5-(azidomethyl)-1-N,3-N-bis[3-[(2S,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl]benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 5288155 |
| Molecular Formula | C27H41N5O14 |
| Molecular Weight | 659.65 g/mol |
| Exact Mass | 659.27 |
| IUPAC Name | 5-(azidomethyl)-1-N,3-N-bis[3-[(2S,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl]benzene-1,3-dicarboxamide |
| SMILES | [N-]=[N+]=NCc1cc(C(=O)NCCCO[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]2O)cc(C(=O)NCCCO[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]2O)c1 |
| InChI | InChI=1S/C27H41N5O14/c28-32-31-10-13-7-14(24(41)29-3-1-5-43-26-22(39)20(37)18(35)16(11-33)45-26)9-15(8-13)25(42)30-4-2-6-44-27-23(40)21(38)19(36)17(12-34)46-27/h7-9,16-23,26-27,33-40H,1-6,10-12H2,(H,29,41)(H,30,42)/t16-,17-,18-,19-,20+,21+,22+,23+,26+,27+/m1/s1 |
| InChIKey | GKRIMQPDERYOML-LHMXEDMUSA-N |
| XLogP | -3.63 |
| TPSA | 305.72 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.65 |
| LogP ≤ 5 | -3.63 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|