About 1-[4-(4-fluorophenyl)piperazin-1-yl]-2-[3-(3-nitrophenyl)-1,2,4-triazol-1-yl]ethanone
1-[4-(4-fluorophenyl)piperazin-1-yl]-2-[3-(3-nitrophenyl)-1,2,4-triazol-1-yl]ethanone (PubChem CID 52883000) has the molecular formula C20H19FN6O3
and a molecular weight of 410.41 g/mol. Its IUPAC name is 1-[4-(4-fluorophenyl)piperazin-1-yl]-2-[3-(3-nitrophenyl)-1,2,4-triazol-1-yl]ethanone.
Molecular Properties
| Compound Name | 1-[4-(4-fluorophenyl)piperazin-1-yl]-2-[3-(3-nitrophenyl)-1,2,4-triazol-1-yl]ethanone |
| PubChem CID | 52883000 |
| Molecular Formula | C20H19FN6O3 |
| Molecular Weight | 410.41 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | 1-[4-(4-fluorophenyl)piperazin-1-yl]-2-[3-(3-nitrophenyl)-1,2,4-triazol-1-yl]ethanone |
| SMILES | O=C(Cn1cnc(-c2cccc([N+](=O)[O-])c2)n1)N1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C20H19FN6O3/c21-16-4-6-17(7-5-16)24-8-10-25(11-9-24)19(28)13-26-14-22-20(23-26)15-2-1-3-18(12-15)27(29)30/h1-7,12,14H,8-11,13H2 |
| InChIKey | VTAGQUYSQOJRFK-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 97.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 410.41 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-(4-fluorophenyl)piperazin-1-yl]-2-[3-(3-nitrophenyl)-1,2,4-triazol-1-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(4-fluorophenyl)piperazin-1-yl]-2-[3-(3-nitrophenyl)-1,2,4-triazol-1-yl]ethanone?
The IUPAC name of 1-[4-(4-fluorophenyl)piperazin-1-yl]-2-[3-(3-nitrophenyl)-1,2,4-triazol-1-yl]ethanone (CID 52883000) is 1-[4-(4-fluorophenyl)piperazin-1-yl]-2-[3-(3-nitrophenyl)-1,2,4-triazol-1-yl]ethanone.
What is the SMILES notation for 1-[4-(4-fluorophenyl)piperazin-1-yl]-2-[3-(3-nitrophenyl)-1,2,4-triazol-1-yl]ethanone?
The canonical SMILES for 1-[4-(4-fluorophenyl)piperazin-1-yl]-2-[3-(3-nitrophenyl)-1,2,4-triazol-1-yl]ethanone is O=C(Cn1cnc(-c2cccc([N+](=O)[O-])c2)n1)N1CCN(c2ccc(F)cc2)CC1.
What is the InChIKey of 1-[4-(4-fluorophenyl)piperazin-1-yl]-2-[3-(3-nitrophenyl)-1,2,4-triazol-1-yl]ethanone?
The InChIKey is VTAGQUYSQOJRFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19FN6O3/c21-16-4-6-17(7-5-16)24-8-10-25(11-9-24)19(28)13-26-14-22-20(23-26)15-2-1-3-18(12-15)27(29)30/h1-7,12,14H,8-11,13H2.
What are the key properties of 1-[4-(4-fluorophenyl)piperazin-1-yl]-2-[3-(3-nitrophenyl)-1,2,4-triazol-1-yl]ethanone?
1-[4-(4-fluorophenyl)piperazin-1-yl]-2-[3-(3-nitrophenyl)-1,2,4-triazol-1-yl]ethanone has a molecular weight of 410.41 g/mol, XLogP of 2.34, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(4-fluorophenyl)piperazin-1-yl]-2-[3-(3-nitrophenyl)-1,2,4-triazol-1-yl]ethanone is sourced from PubChem (CID 52883000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).