C7H12N3O4+ — CID 5288586
(4S,5S,6R,7R)-7-(hydroxymethyl)-4,5,6,7-tetrahydro-1H-triazolo[1,5-a]pyridin-8-ium-4,5,6-triol (PubChem CID 5288586) has the molecular formula C7H12N3O4+ and a molecular weight of 202.19 g/mol. Its IUPAC name is (4S,5S,6R,7R)-7-(hydroxymethyl)-4,5,6,7-tetrahydro-1H-triazolo[1,5-a]pyridin-8-ium-4,5,6-triol.
| Compound Name | (4S,5S,6R,7R)-7-(hydroxymethyl)-4,5,6,7-tetrahydro-1H-triazolo[1,5-a]pyridin-8-ium-4,5,6-triol |
|---|---|
| PubChem CID | 5288586 |
| Molecular Formula | C7H12N3O4+ |
| Molecular Weight | 202.19 g/mol |
| Exact Mass | 202.08 |
| IUPAC Name | (4S,5S,6R,7R)-7-(hydroxymethyl)-4,5,6,7-tetrahydro-1H-triazolo[1,5-a]pyridin-8-ium-4,5,6-triol |
| SMILES | OC[C@@H]1[C@@H](O)[C@H](O)[C@@H](O)c2cn[nH][n+]21 |
| InChI | InChI=1S/C7H11N3O4/c11-2-4-6(13)7(14)5(12)3-1-8-9-10(3)4/h1,4-7,11-14H,2H2/p+1/t4-,5+,6-,7-/m1/s1 |
| InChIKey | QTNWFPNNMUCBLD-XZBKPIIZSA-O |
| XLogP | -3.00 |
| TPSA | 113.48 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.19 |
| LogP ≤ 5 | -3.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|