About (3S)-3,7-diaminoheptan-2-one
(3S)-3,7-diaminoheptan-2-one (PubChem CID 5288718) has the molecular formula C7H16N2O
and a molecular weight of 144.22 g/mol. Its IUPAC name is (3S)-3,7-diaminoheptan-2-one.
Molecular Properties
| Compound Name | (3S)-3,7-diaminoheptan-2-one |
| PubChem CID | 5288718 |
| Molecular Formula | C7H16N2O |
| Molecular Weight | 144.22 g/mol |
| Exact Mass | 144.13 |
| IUPAC Name | (3S)-3,7-diaminoheptan-2-one |
| SMILES | CC(=O)[C@@H](N)CCCCN |
| InChI | InChI=1S/C7H16N2O/c1-6(10)7(9)4-2-3-5-8/h7H,2-5,8-9H2,1H3/t7-/m0/s1 |
| InChIKey | FADKJNSSIWTVAI-ZETCQYMHSA-N |
| XLogP | 0.03 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.22 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (3S)-3,7-diaminoheptan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3,7-diaminoheptan-2-one?
The IUPAC name of (3S)-3,7-diaminoheptan-2-one (CID 5288718) is (3S)-3,7-diaminoheptan-2-one.
What is the SMILES notation for (3S)-3,7-diaminoheptan-2-one?
The canonical SMILES for (3S)-3,7-diaminoheptan-2-one is CC(=O)[C@@H](N)CCCCN.
What is the InChIKey of (3S)-3,7-diaminoheptan-2-one?
The InChIKey is FADKJNSSIWTVAI-ZETCQYMHSA-N. The full InChI is InChI=1S/C7H16N2O/c1-6(10)7(9)4-2-3-5-8/h7H,2-5,8-9H2,1H3/t7-/m0/s1.
What are the key properties of (3S)-3,7-diaminoheptan-2-one?
(3S)-3,7-diaminoheptan-2-one has a molecular weight of 144.22 g/mol, XLogP of 0.03, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3,7-diaminoheptan-2-one is sourced from PubChem (CID 5288718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).