C7H14O5S — CID 5288724
(2S,3R,4R,5S,6R)-6-(hydroxymethyl)-5-methylsulfanyloxane-2,3,4-triol (PubChem CID 5288724) has the molecular formula C7H14O5S and a molecular weight of 210.25 g/mol. Its IUPAC name is (2S,3R,4R,5S,6R)-6-(hydroxymethyl)-5-methylsulfanyloxane-2,3,4-triol.
| Compound Name | (2S,3R,4R,5S,6R)-6-(hydroxymethyl)-5-methylsulfanyloxane-2,3,4-triol |
|---|---|
| PubChem CID | 5288724 |
| Molecular Formula | C7H14O5S |
| Molecular Weight | 210.25 g/mol |
| Exact Mass | 210.06 |
| IUPAC Name | (2S,3R,4R,5S,6R)-6-(hydroxymethyl)-5-methylsulfanyloxane-2,3,4-triol |
| SMILES | CS[C@H]1[C@H](O)[C@@H](O)[C@@H](O)O[C@@H]1CO |
| InChI | InChI=1S/C7H14O5S/c1-13-6-3(2-8)12-7(11)5(10)4(6)9/h3-11H,2H2,1H3/t3-,4-,5-,6-,7+/m1/s1 |
| InChIKey | UYUQSQYXZFSOEM-GKHCUFPYSA-N |
| XLogP | -1.85 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.25 |
| LogP ≤ 5 | -1.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |