About 4-methoxybutyl 1-methyl-6-oxo-4,5-dihydropyridazine-3-carboxylate
4-methoxybutyl 1-methyl-6-oxo-4,5-dihydropyridazine-3-carboxylate (PubChem CID 52887560) has the molecular formula C11H18N2O4
and a molecular weight of 242.27 g/mol. Its IUPAC name is 4-methoxybutyl 1-methyl-6-oxo-4,5-dihydropyridazine-3-carboxylate.
Molecular Properties
| Compound Name | 4-methoxybutyl 1-methyl-6-oxo-4,5-dihydropyridazine-3-carboxylate |
| PubChem CID | 52887560 |
| Molecular Formula | C11H18N2O4 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | 4-methoxybutyl 1-methyl-6-oxo-4,5-dihydropyridazine-3-carboxylate |
| SMILES | COCCCCOC(=O)C1=NN(C)C(=O)CC1 |
| InChI | InChI=1S/C11H18N2O4/c1-13-10(14)6-5-9(12-13)11(15)17-8-4-3-7-16-2/h3-8H2,1-2H3 |
| InChIKey | ZPYLDCORWLFSQU-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-methoxybutyl 1-methyl-6-oxo-4,5-dihydropyridazine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxybutyl 1-methyl-6-oxo-4,5-dihydropyridazine-3-carboxylate?
The IUPAC name of 4-methoxybutyl 1-methyl-6-oxo-4,5-dihydropyridazine-3-carboxylate (CID 52887560) is 4-methoxybutyl 1-methyl-6-oxo-4,5-dihydropyridazine-3-carboxylate.
What is the SMILES notation for 4-methoxybutyl 1-methyl-6-oxo-4,5-dihydropyridazine-3-carboxylate?
The canonical SMILES for 4-methoxybutyl 1-methyl-6-oxo-4,5-dihydropyridazine-3-carboxylate is COCCCCOC(=O)C1=NN(C)C(=O)CC1.
What is the InChIKey of 4-methoxybutyl 1-methyl-6-oxo-4,5-dihydropyridazine-3-carboxylate?
The InChIKey is ZPYLDCORWLFSQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2O4/c1-13-10(14)6-5-9(12-13)11(15)17-8-4-3-7-16-2/h3-8H2,1-2H3.
What are the key properties of 4-methoxybutyl 1-methyl-6-oxo-4,5-dihydropyridazine-3-carboxylate?
4-methoxybutyl 1-methyl-6-oxo-4,5-dihydropyridazine-3-carboxylate has a molecular weight of 242.27 g/mol, XLogP of 0.56, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxybutyl 1-methyl-6-oxo-4,5-dihydropyridazine-3-carboxylate is sourced from PubChem (CID 52887560), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).