About (3R)-3,5-dihydroxy-3-methylpentanoate
(3R)-3,5-dihydroxy-3-methylpentanoate (PubChem CID 5288798) has the molecular formula C6H11O4-
and a molecular weight of 147.15 g/mol. Its IUPAC name is (3R)-3,5-dihydroxy-3-methylpentanoate.
Molecular Properties
| Compound Name | (3R)-3,5-dihydroxy-3-methylpentanoate |
| PubChem CID | 5288798 |
| Molecular Formula | C6H11O4- |
| Molecular Weight | 147.15 g/mol |
| Exact Mass | 147.07 |
| IUPAC Name | (3R)-3,5-dihydroxy-3-methylpentanoate |
| SMILES | C[C@@](O)(CCO)CC(=O)[O-] |
| InChI | InChI=1S/C6H12O4/c1-6(10,2-3-7)4-5(8)9/h7,10H,2-4H2,1H3,(H,8,9)/p-1/t6-/m1/s1 |
| InChIKey | KJTLQQUUPVSXIM-ZCFIWIBFSA-M |
| XLogP | -1.74 |
| TPSA | 80.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.15 |
| LogP ≤ 5 | -1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3R)-3,5-dihydroxy-3-methylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3,5-dihydroxy-3-methylpentanoate?
The IUPAC name of (3R)-3,5-dihydroxy-3-methylpentanoate (CID 5288798) is (3R)-3,5-dihydroxy-3-methylpentanoate.
What is the SMILES notation for (3R)-3,5-dihydroxy-3-methylpentanoate?
The canonical SMILES for (3R)-3,5-dihydroxy-3-methylpentanoate is C[C@@](O)(CCO)CC(=O)[O-].
What is the InChIKey of (3R)-3,5-dihydroxy-3-methylpentanoate?
The InChIKey is KJTLQQUUPVSXIM-ZCFIWIBFSA-M. The full InChI is InChI=1S/C6H12O4/c1-6(10,2-3-7)4-5(8)9/h7,10H,2-4H2,1H3,(H,8,9)/p-1/t6-/m1/s1.
What are the key properties of (3R)-3,5-dihydroxy-3-methylpentanoate?
(3R)-3,5-dihydroxy-3-methylpentanoate has a molecular weight of 147.15 g/mol, XLogP of -1.74, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3,5-dihydroxy-3-methylpentanoate is sourced from PubChem (CID 5288798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).