C21H14O7 — CID 5289026
methyl 5,7-dihydroxy-2-methyl-4,6,11-trioxo-3H-tetracene-1-carboxylate (PubChem CID 5289026) has the molecular formula C21H14O7 and a molecular weight of 378.34 g/mol. Its IUPAC name is methyl 5,7-dihydroxy-2-methyl-4,6,11-trioxo-3H-tetracene-1-carboxylate.
| Compound Name | methyl 5,7-dihydroxy-2-methyl-4,6,11-trioxo-3H-tetracene-1-carboxylate |
|---|---|
| PubChem CID | 5289026 |
| Molecular Formula | C21H14O7 |
| Molecular Weight | 378.34 g/mol |
| Exact Mass | 378.07 |
| IUPAC Name | methyl 5,7-dihydroxy-2-methyl-4,6,11-trioxo-3H-tetracene-1-carboxylate |
| SMILES | COC(=O)C1=C(C)CC(=O)c2c1cc1c(c2O)C(=O)c2c(O)cccc2C1=O |
| InChI | InChI=1S/C21H14O7/c1-8-6-13(23)16-10(14(8)21(27)28-2)7-11-17(20(16)26)19(25)15-9(18(11)24)4-3-5-12(15)22/h3-5,7,22,26H,6H2,1-2H3 |
| InChIKey | QHNJNOBWURJIEK-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 117.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.34 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|