C13H14N2O4 — CID 528903
5-(1-hydroxyethyl)-1-methyl-5-phenyl-1,3-diazinane-2,4,6-trione (PubChem CID 528903) has the molecular formula C13H14N2O4 and a molecular weight of 262.26 g/mol. Its IUPAC name is 5-(1-hydroxyethyl)-1-methyl-5-phenyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-(1-hydroxyethyl)-1-methyl-5-phenyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 528903 |
| Molecular Formula | C13H14N2O4 |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | 5-(1-hydroxyethyl)-1-methyl-5-phenyl-1,3-diazinane-2,4,6-trione |
| SMILES | CC(O)C1(c2ccccc2)C(=O)NC(=O)N(C)C1=O |
| InChI | InChI=1S/C13H14N2O4/c1-8(16)13(9-6-4-3-5-7-9)10(17)14-12(19)15(2)11(13)18/h3-8,16H,1-2H3,(H,14,17,19) |
| InChIKey | QQTAUICLIXCZDS-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.26 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|