2-(2-formylphenyl)acetic acid

C9H8O3 — CID 5289058

IUPAC2-(2-formylphenyl)acetic acid
SMILESO=Cc1ccccc1CC(=O)O
InChIInChI=1S/C9H8O3/c10-6-8-4-2-1-3-7(8)5-9(11)12/h1-4,6H,5H2,(H,11,12)
InChIKeyQNLSLYKWBHYEHK-UHFFFAOYSA-N
MW164.16 g/mol
LogP1.13
Rot. Bonds3

About 2-(2-formylphenyl)acetic acid

2-(2-formylphenyl)acetic acid (PubChem CID 5289058) has the molecular formula C9H8O3 and a molecular weight of 164.16 g/mol. Its IUPAC name is 2-(2-formylphenyl)acetic acid.

Molecular Properties

Compound Name2-(2-formylphenyl)acetic acid
PubChem CID5289058
Molecular FormulaC9H8O3
Molecular Weight164.16 g/mol
Exact Mass164.05
IUPAC Name2-(2-formylphenyl)acetic acid
SMILESO=Cc1ccccc1CC(=O)O
InChIInChI=1S/C9H8O3/c10-6-8-4-2-1-3-7(8)5-9(11)12/h1-4,6H,5H2,(H,11,12)
InChIKeyQNLSLYKWBHYEHK-UHFFFAOYSA-N
XLogP1.13
TPSA54.37 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500164.16
LogP ≤ 51.13
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aldehyde', 'substructure': 'N/A'}

Analyze 2-(2-formylphenyl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2-formylphenyl)acetic acid?
The IUPAC name of 2-(2-formylphenyl)acetic acid (CID 5289058) is 2-(2-formylphenyl)acetic acid.
What is the SMILES notation for 2-(2-formylphenyl)acetic acid?
The canonical SMILES for 2-(2-formylphenyl)acetic acid is O=Cc1ccccc1CC(=O)O.
What is the InChIKey of 2-(2-formylphenyl)acetic acid?
The InChIKey is QNLSLYKWBHYEHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8O3/c10-6-8-4-2-1-3-7(8)5-9(11)12/h1-4,6H,5H2,(H,11,12).
What are the key properties of 2-(2-formylphenyl)acetic acid?
2-(2-formylphenyl)acetic acid has a molecular weight of 164.16 g/mol, XLogP of 1.13, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-formylphenyl)acetic acid is sourced from PubChem (CID 5289058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).