C10H15NO3 — CID 528906
3,3-diethyl-5-methylpiperidine-2,4,6-trione (PubChem CID 528906) has the molecular formula C10H15NO3 and a molecular weight of 197.23 g/mol. Its IUPAC name is 3,3-diethyl-5-methylpiperidine-2,4,6-trione.
| Compound Name | 3,3-diethyl-5-methylpiperidine-2,4,6-trione |
|---|---|
| PubChem CID | 528906 |
| Molecular Formula | C10H15NO3 |
| Molecular Weight | 197.23 g/mol |
| Exact Mass | 197.11 |
| IUPAC Name | 3,3-diethyl-5-methylpiperidine-2,4,6-trione |
| SMILES | CCC1(CC)C(=O)NC(=O)C(C)C1=O |
| InChI | InChI=1S/C10H15NO3/c1-4-10(5-2)7(12)6(3)8(13)11-9(10)14/h6H,4-5H2,1-3H3,(H,11,13,14) |
| InChIKey | MBJIJGJXNJWDEM-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.23 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|