C19H24ClN3O2S — CID 52891662
butyl 2-[[5-(2-chlorophenyl)-4-cyclopentyl-1,2,4-triazol-3-yl]sulfanyl]acetate (PubChem CID 52891662) has the molecular formula C19H24ClN3O2S and a molecular weight of 393.94 g/mol. Its IUPAC name is butyl 2-[[5-(2-chlorophenyl)-4-cyclopentyl-1,2,4-triazol-3-yl]sulfanyl]acetate.
| Compound Name | butyl 2-[[5-(2-chlorophenyl)-4-cyclopentyl-1,2,4-triazol-3-yl]sulfanyl]acetate |
|---|---|
| PubChem CID | 52891662 |
| Molecular Formula | C19H24ClN3O2S |
| Molecular Weight | 393.94 g/mol |
| Exact Mass | 393.13 |
| IUPAC Name | butyl 2-[[5-(2-chlorophenyl)-4-cyclopentyl-1,2,4-triazol-3-yl]sulfanyl]acetate |
| SMILES | CCCCOC(=O)CSc1nnc(-c2ccccc2Cl)n1C1CCCC1 |
| InChI | InChI=1S/C19H24ClN3O2S/c1-2-3-12-25-17(24)13-26-19-22-21-18(15-10-6-7-11-16(15)20)23(19)14-8-4-5-9-14/h6-7,10-11,14H,2-5,8-9,12-13H2,1H3 |
| InChIKey | FNSPXJNVFKEJCP-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.94 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|