C20H32 — CID 5289279
2-[(1E,3E,5E,7E)-3,7-dimethylnona-1,3,5,7-tetraenyl]-1,1,3-trimethylcyclohexane (PubChem CID 5289279) has the molecular formula C20H32 and a molecular weight of 272.48 g/mol. Its IUPAC name is 2-[(1E,3E,5E,7E)-3,7-dimethylnona-1,3,5,7-tetraenyl]-1,1,3-trimethylcyclohexane.
| Compound Name | 2-[(1E,3E,5E,7E)-3,7-dimethylnona-1,3,5,7-tetraenyl]-1,1,3-trimethylcyclohexane |
|---|---|
| PubChem CID | 5289279 |
| Molecular Formula | C20H32 |
| Molecular Weight | 272.48 g/mol |
| Exact Mass | 272.25 |
| IUPAC Name | 2-[(1E,3E,5E,7E)-3,7-dimethylnona-1,3,5,7-tetraenyl]-1,1,3-trimethylcyclohexane |
| SMILES | C/C=C(C)/C=C/C=C(C)/C=C/C1C(C)CCCC1(C)C |
| InChI | InChI=1S/C20H32/c1-7-16(2)10-8-11-17(3)13-14-19-18(4)12-9-15-20(19,5)6/h7-8,10-11,13-14,18-19H,9,12,15H2,1-6H3/b10-8+,14-13+,16-7+,17-11+ |
| InChIKey | GXXQDYIZNAUBPZ-JWBAUCAFSA-N |
| XLogP | 6.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.48 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|