About (1S)-N-prop-2-ynyl-2,3-dihydro-1H-inden-1-amine
(1S)-N-prop-2-ynyl-2,3-dihydro-1H-inden-1-amine (PubChem CID 5289310) has the molecular formula C12H13N
and a molecular weight of 171.24 g/mol. Its IUPAC name is (1S)-N-prop-2-ynyl-2,3-dihydro-1H-inden-1-amine.
Molecular Properties
| Compound Name | (1S)-N-prop-2-ynyl-2,3-dihydro-1H-inden-1-amine |
| PubChem CID | 5289310 |
| Molecular Formula | C12H13N |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.10 |
| IUPAC Name | (1S)-N-prop-2-ynyl-2,3-dihydro-1H-inden-1-amine |
| SMILES | C#CCN[C@H]1CCc2ccccc21 |
| InChI | InChI=1S/C12H13N/c1-2-9-13-12-8-7-10-5-3-4-6-11(10)12/h1,3-6,12-13H,7-9H2/t12-/m0/s1 |
| InChIKey | RUOKEQAAGRXIBM-LBPRGKRZSA-N |
| XLogP | 1.90 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (1S)-N-prop-2-ynyl-2,3-dihydro-1H-inden-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-N-prop-2-ynyl-2,3-dihydro-1H-inden-1-amine?
The IUPAC name of (1S)-N-prop-2-ynyl-2,3-dihydro-1H-inden-1-amine (CID 5289310) is (1S)-N-prop-2-ynyl-2,3-dihydro-1H-inden-1-amine.
What is the SMILES notation for (1S)-N-prop-2-ynyl-2,3-dihydro-1H-inden-1-amine?
The canonical SMILES for (1S)-N-prop-2-ynyl-2,3-dihydro-1H-inden-1-amine is C#CCN[C@H]1CCc2ccccc21.
What is the InChIKey of (1S)-N-prop-2-ynyl-2,3-dihydro-1H-inden-1-amine?
The InChIKey is RUOKEQAAGRXIBM-LBPRGKRZSA-N. The full InChI is InChI=1S/C12H13N/c1-2-9-13-12-8-7-10-5-3-4-6-11(10)12/h1,3-6,12-13H,7-9H2/t12-/m0/s1.
What are the key properties of (1S)-N-prop-2-ynyl-2,3-dihydro-1H-inden-1-amine?
(1S)-N-prop-2-ynyl-2,3-dihydro-1H-inden-1-amine has a molecular weight of 171.24 g/mol, XLogP of 1.90, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-N-prop-2-ynyl-2,3-dihydro-1H-inden-1-amine is sourced from PubChem (CID 5289310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).