C27H19N5Ru+2 — CID 5289316
2,6-dipyridin-2-ylpyridine;1,10-phenanthroline;ruthenium(2+) (PubChem CID 5289316) has the molecular formula C27H19N5Ru+2 and a molecular weight of 514.55 g/mol. Its IUPAC name is 2,6-dipyridin-2-ylpyridine;1,10-phenanthroline;ruthenium(2+).
| Compound Name | 2,6-dipyridin-2-ylpyridine;1,10-phenanthroline;ruthenium(2+) |
|---|---|
| PubChem CID | 5289316 |
| Molecular Formula | C27H19N5Ru+2 |
| Molecular Weight | 514.55 g/mol |
| Exact Mass | 515.07 |
| IUPAC Name | 2,6-dipyridin-2-ylpyridine;1,10-phenanthroline;ruthenium(2+) |
| SMILES | [Ru+2].c1ccc(-c2cccc(-c3ccccn3)n2)nc1.c1cnc2c(c1)ccc1cccnc12 |
| InChI | InChI=1S/C15H11N3.C12H8N2.Ru/c1-3-10-16-12(6-1)14-8-5-9-15(18-14)13-7-2-4-11-17-13;1-3-9-5-6-10-4-2-8-14-12(10)11(9)13-7-1;/h1-11H;1-8H;/q;;+2 |
| InChIKey | XMPKRNOGWDEKFE-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 64.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.55 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|