About 4-(1,3,2-dioxaborolan-2-yloxymethyl)benzenecarboximidamide
4-(1,3,2-dioxaborolan-2-yloxymethyl)benzenecarboximidamide (PubChem CID 5289340) has the molecular formula C10H13BN2O3
and a molecular weight of 220.04 g/mol. Its IUPAC name is 4-(1,3,2-dioxaborolan-2-yloxymethyl)benzenecarboximidamide.
Molecular Properties
| Compound Name | 4-(1,3,2-dioxaborolan-2-yloxymethyl)benzenecarboximidamide |
| PubChem CID | 5289340 |
| Molecular Formula | C10H13BN2O3 |
| Molecular Weight | 220.04 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | 4-(1,3,2-dioxaborolan-2-yloxymethyl)benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(COB2OCCO2)cc1 |
| InChI | InChI=1S/C10H13BN2O3/c12-10(13)9-3-1-8(2-4-9)7-16-11-14-5-6-15-11/h1-4H,5-7H2,(H3,12,13) |
| InChIKey | XCLFQXCQQHVLJQ-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 77.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.04 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 4-(1,3,2-dioxaborolan-2-yloxymethyl)benzenecarboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,3,2-dioxaborolan-2-yloxymethyl)benzenecarboximidamide?
The IUPAC name of 4-(1,3,2-dioxaborolan-2-yloxymethyl)benzenecarboximidamide (CID 5289340) is 4-(1,3,2-dioxaborolan-2-yloxymethyl)benzenecarboximidamide.
What is the SMILES notation for 4-(1,3,2-dioxaborolan-2-yloxymethyl)benzenecarboximidamide?
The canonical SMILES for 4-(1,3,2-dioxaborolan-2-yloxymethyl)benzenecarboximidamide is [H]/N=C(\N)c1ccc(COB2OCCO2)cc1.
What is the InChIKey of 4-(1,3,2-dioxaborolan-2-yloxymethyl)benzenecarboximidamide?
The InChIKey is XCLFQXCQQHVLJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13BN2O3/c12-10(13)9-3-1-8(2-4-9)7-16-11-14-5-6-15-11/h1-4H,5-7H2,(H3,12,13).
What are the key properties of 4-(1,3,2-dioxaborolan-2-yloxymethyl)benzenecarboximidamide?
4-(1,3,2-dioxaborolan-2-yloxymethyl)benzenecarboximidamide has a molecular weight of 220.04 g/mol, XLogP of 0.52, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,3,2-dioxaborolan-2-yloxymethyl)benzenecarboximidamide is sourced from PubChem (CID 5289340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).