C10H16O14P2 — CID 5289376
(3R,4S,5R)-5-[(1S)-1-carboxy-1-phosphonooxyethoxy]-4-hydroxy-3-phosphonooxycyclohexene-1-carboxylic acid (PubChem CID 5289376) has the molecular formula C10H16O14P2 and a molecular weight of 422.17 g/mol. Its IUPAC name is (3R,4S,5R)-5-[(1S)-1-carboxy-1-phosphonooxyethoxy]-4-hydroxy-3-phosphonooxycyclohexene-1-carboxylic acid.
| Compound Name | (3R,4S,5R)-5-[(1S)-1-carboxy-1-phosphonooxyethoxy]-4-hydroxy-3-phosphonooxycyclohexene-1-carboxylic acid |
|---|---|
| PubChem CID | 5289376 |
| Molecular Formula | C10H16O14P2 |
| Molecular Weight | 422.17 g/mol |
| Exact Mass | 422.00 |
| IUPAC Name | (3R,4S,5R)-5-[(1S)-1-carboxy-1-phosphonooxyethoxy]-4-hydroxy-3-phosphonooxycyclohexene-1-carboxylic acid |
| SMILES | C[C@](O[C@@H]1CC(C(=O)O)=C[C@@H](OP(=O)(O)O)[C@H]1O)(OP(=O)(O)O)C(=O)O |
| InChI | InChI=1S/C10H16O14P2/c1-10(9(14)15,24-26(19,20)21)22-5-2-4(8(12)13)3-6(7(5)11)23-25(16,17)18/h3,5-7,11H,2H2,1H3,(H,12,13)(H,14,15)(H2,16,17,18)(H2,19,20,21)/t5-,6-,7+,10+/m1/s1 |
| InChIKey | QUQKBSPZUVNKIF-JQCUSGDOSA-N |
| XLogP | -1.46 |
| TPSA | 237.58 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.17 |
| LogP ≤ 5 | -1.46 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|