About trimethyl-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]silane
trimethyl-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]silane (PubChem CID 528938) has the molecular formula C17H30OSi
and a molecular weight of 278.51 g/mol. Its IUPAC name is trimethyl-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]silane.
Molecular Properties
| Compound Name | trimethyl-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]silane |
| PubChem CID | 528938 |
| Molecular Formula | C17H30OSi |
| Molecular Weight | 278.51 g/mol |
| Exact Mass | 278.21 |
| IUPAC Name | trimethyl-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]silane |
| SMILES | CC(C)(C)CC(C)(C)c1ccc(O[Si](C)(C)C)cc1 |
| InChI | InChI=1S/C17H30OSi/c1-16(2,3)13-17(4,5)14-9-11-15(12-10-14)18-19(6,7)8/h9-12H,13H2,1-8H3 |
| InChIKey | LGVXTVHRVKVONW-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 278.51 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze trimethyl-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethyl-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]silane?
The IUPAC name of trimethyl-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]silane (CID 528938) is trimethyl-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]silane.
What is the SMILES notation for trimethyl-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]silane?
The canonical SMILES for trimethyl-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]silane is CC(C)(C)CC(C)(C)c1ccc(O[Si](C)(C)C)cc1.
What is the InChIKey of trimethyl-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]silane?
The InChIKey is LGVXTVHRVKVONW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H30OSi/c1-16(2,3)13-17(4,5)14-9-11-15(12-10-14)18-19(6,7)8/h9-12H,13H2,1-8H3.
What are the key properties of trimethyl-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]silane?
trimethyl-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]silane has a molecular weight of 278.51 g/mol, XLogP of 5.61, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for trimethyl-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]silane is sourced from PubChem (CID 528938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).