About 4-formyl-1,3-thiazol-2-olate
4-formyl-1,3-thiazol-2-olate (PubChem CID 5289512) has the molecular formula C4H2NO2S-
and a molecular weight of 128.13 g/mol. Its IUPAC name is 4-formyl-1,3-thiazol-2-olate.
Molecular Properties
| Compound Name | 4-formyl-1,3-thiazol-2-olate |
| PubChem CID | 5289512 |
| Molecular Formula | C4H2NO2S- |
| Molecular Weight | 128.13 g/mol |
| Exact Mass | 127.98 |
| IUPAC Name | 4-formyl-1,3-thiazol-2-olate |
| SMILES | O=Cc1csc([O-])n1 |
| InChI | InChI=1S/C4H3NO2S/c6-1-3-2-8-4(7)5-3/h1-2H,(H,5,7)/p-1 |
| InChIKey | ZOCZPBZQSKHSOU-UHFFFAOYSA-M |
| XLogP | 0.03 |
| TPSA | 53.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.13 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-formyl-1,3-thiazol-2-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-formyl-1,3-thiazol-2-olate?
The IUPAC name of 4-formyl-1,3-thiazol-2-olate (CID 5289512) is 4-formyl-1,3-thiazol-2-olate.
What is the SMILES notation for 4-formyl-1,3-thiazol-2-olate?
The canonical SMILES for 4-formyl-1,3-thiazol-2-olate is O=Cc1csc([O-])n1.
What is the InChIKey of 4-formyl-1,3-thiazol-2-olate?
The InChIKey is ZOCZPBZQSKHSOU-UHFFFAOYSA-M. The full InChI is InChI=1S/C4H3NO2S/c6-1-3-2-8-4(7)5-3/h1-2H,(H,5,7)/p-1.
What are the key properties of 4-formyl-1,3-thiazol-2-olate?
4-formyl-1,3-thiazol-2-olate has a molecular weight of 128.13 g/mol, XLogP of 0.03, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-formyl-1,3-thiazol-2-olate is sourced from PubChem (CID 5289512), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).