(4R)-4-aminohexanoic acid

C6H13NO2 — CID 5289553

IUPAC(4R)-4-aminohexanoic acid
SMILESCC[C@@H](N)CCC(=O)O
InChIInChI=1S/C6H13NO2/c1-2-5(7)3-4-6(8)9/h5H,2-4,7H2,1H3,(H,8,9)/t5-/m1/s1
InChIKeyROFNJLCLYMMXCT-RXMQYKEDSA-N
MW131.18 g/mol
LogP0.59
Rot. Bonds4

About (4R)-4-aminohexanoic acid

(4R)-4-aminohexanoic acid (PubChem CID 5289553) has the molecular formula C6H13NO2 and a molecular weight of 131.18 g/mol. Its IUPAC name is (4R)-4-aminohexanoic acid.

Molecular Properties

Compound Name(4R)-4-aminohexanoic acid
PubChem CID5289553
Molecular FormulaC6H13NO2
Molecular Weight131.18 g/mol
Exact Mass131.09
IUPAC Name(4R)-4-aminohexanoic acid
SMILESCC[C@@H](N)CCC(=O)O
InChIInChI=1S/C6H13NO2/c1-2-5(7)3-4-6(8)9/h5H,2-4,7H2,1H3,(H,8,9)/t5-/m1/s1
InChIKeyROFNJLCLYMMXCT-RXMQYKEDSA-N
XLogP0.59
TPSA63.32 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms9
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500131.18
LogP ≤ 50.59
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze (4R)-4-aminohexanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (4R)-4-aminohexanoic acid?
The IUPAC name of (4R)-4-aminohexanoic acid (CID 5289553) is (4R)-4-aminohexanoic acid.
What is the SMILES notation for (4R)-4-aminohexanoic acid?
The canonical SMILES for (4R)-4-aminohexanoic acid is CC[C@@H](N)CCC(=O)O.
What is the InChIKey of (4R)-4-aminohexanoic acid?
The InChIKey is ROFNJLCLYMMXCT-RXMQYKEDSA-N. The full InChI is InChI=1S/C6H13NO2/c1-2-5(7)3-4-6(8)9/h5H,2-4,7H2,1H3,(H,8,9)/t5-/m1/s1.
What are the key properties of (4R)-4-aminohexanoic acid?
(4R)-4-aminohexanoic acid has a molecular weight of 131.18 g/mol, XLogP of 0.59, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-4-aminohexanoic acid is sourced from PubChem (CID 5289553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).