C8H15N — CID 52897209
cis-(1S,2R)-2-prop-2-enylcyclopentan-1-amine (PubChem CID 52897209) has the molecular formula C8H15N and a molecular weight of 125.22 g/mol. Its IUPAC name is cis-(1S,2R)-2-prop-2-enylcyclopentan-1-amine.
| Compound Name | cis-(1S,2R)-2-prop-2-enylcyclopentan-1-amine |
|---|---|
| PubChem CID | 52897209 |
| Molecular Formula | C8H15N |
| Molecular Weight | 125.22 g/mol |
| Exact Mass | 125.12 |
| IUPAC Name | cis-(1S,2R)-2-prop-2-enylcyclopentan-1-amine |
| SMILES | C=CC[C@H]1CCC[C@@H]1N |
| InChI | InChI=1S/C8H15N/c1-2-4-7-5-3-6-8(7)9/h2,7-8H,1,3-6,9H2/t7-,8-/m0/s1 |
| InChIKey | ZYSFCZXVKZBMTC-YUMQZZPRSA-N |
| XLogP | 1.69 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 125.22 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|