About methyl 3-(3-chloro-1H-1,2,4-triazol-5-yl)propanoate
methyl 3-(3-chloro-1H-1,2,4-triazol-5-yl)propanoate (PubChem CID 52897320) has the molecular formula C6H8ClN3O2
and a molecular weight of 189.60 g/mol. Its IUPAC name is methyl 3-(3-chloro-1H-1,2,4-triazol-5-yl)propanoate.
Molecular Properties
| Compound Name | methyl 3-(3-chloro-1H-1,2,4-triazol-5-yl)propanoate |
| PubChem CID | 52897320 |
| Molecular Formula | C6H8ClN3O2 |
| Molecular Weight | 189.60 g/mol |
| Exact Mass | 189.03 |
| IUPAC Name | methyl 3-(3-chloro-1H-1,2,4-triazol-5-yl)propanoate |
| SMILES | COC(=O)CCc1nc(Cl)n[nH]1 |
| InChI | InChI=1S/C6H8ClN3O2/c1-12-5(11)3-2-4-8-6(7)10-9-4/h2-3H2,1H3,(H,8,9,10) |
| InChIKey | QJYOJRKRRFXRCU-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.60 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 3-(3-chloro-1H-1,2,4-triazol-5-yl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-(3-chloro-1H-1,2,4-triazol-5-yl)propanoate?
The IUPAC name of methyl 3-(3-chloro-1H-1,2,4-triazol-5-yl)propanoate (CID 52897320) is methyl 3-(3-chloro-1H-1,2,4-triazol-5-yl)propanoate.
What is the SMILES notation for methyl 3-(3-chloro-1H-1,2,4-triazol-5-yl)propanoate?
The canonical SMILES for methyl 3-(3-chloro-1H-1,2,4-triazol-5-yl)propanoate is COC(=O)CCc1nc(Cl)n[nH]1.
What is the InChIKey of methyl 3-(3-chloro-1H-1,2,4-triazol-5-yl)propanoate?
The InChIKey is QJYOJRKRRFXRCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8ClN3O2/c1-12-5(11)3-2-4-8-6(7)10-9-4/h2-3H2,1H3,(H,8,9,10).
What are the key properties of methyl 3-(3-chloro-1H-1,2,4-triazol-5-yl)propanoate?
methyl 3-(3-chloro-1H-1,2,4-triazol-5-yl)propanoate has a molecular weight of 189.60 g/mol, XLogP of 0.56, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(3-chloro-1H-1,2,4-triazol-5-yl)propanoate is sourced from PubChem (CID 52897320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).