methyl 3-(3-bromo-1H-1,2,4-triazol-5-yl)propanoate

C6H8BrN3O2 — CID 52897321

IUPACmethyl 3-(3-bromo-1H-1,2,4-triazol-5-yl)propanoate
SMILESCOC(=O)CCc1nc(Br)n[nH]1
InChIInChI=1S/C6H8BrN3O2/c1-12-5(11)3-2-4-8-6(7)10-9-4/h2-3H2,1H3,(H,8,9,10)
InChIKeyGKKNFKKYCFGEAL-UHFFFAOYSA-N
MW234.05 g/mol
LogP0.67
Rot. Bonds3

About methyl 3-(3-bromo-1H-1,2,4-triazol-5-yl)propanoate

methyl 3-(3-bromo-1H-1,2,4-triazol-5-yl)propanoate (PubChem CID 52897321) has the molecular formula C6H8BrN3O2 and a molecular weight of 234.05 g/mol. Its IUPAC name is methyl 3-(3-bromo-1H-1,2,4-triazol-5-yl)propanoate.

Molecular Properties

Compound Namemethyl 3-(3-bromo-1H-1,2,4-triazol-5-yl)propanoate
PubChem CID52897321
Molecular FormulaC6H8BrN3O2
Molecular Weight234.05 g/mol
Exact Mass232.98
IUPAC Namemethyl 3-(3-bromo-1H-1,2,4-triazol-5-yl)propanoate
SMILESCOC(=O)CCc1nc(Br)n[nH]1
InChIInChI=1S/C6H8BrN3O2/c1-12-5(11)3-2-4-8-6(7)10-9-4/h2-3H2,1H3,(H,8,9,10)
InChIKeyGKKNFKKYCFGEAL-UHFFFAOYSA-N
XLogP0.67
TPSA67.87 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500234.05
LogP ≤ 50.67
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze methyl 3-(3-bromo-1H-1,2,4-triazol-5-yl)propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-(3-bromo-1H-1,2,4-triazol-5-yl)propanoate?
The IUPAC name of methyl 3-(3-bromo-1H-1,2,4-triazol-5-yl)propanoate (CID 52897321) is methyl 3-(3-bromo-1H-1,2,4-triazol-5-yl)propanoate.
What is the SMILES notation for methyl 3-(3-bromo-1H-1,2,4-triazol-5-yl)propanoate?
The canonical SMILES for methyl 3-(3-bromo-1H-1,2,4-triazol-5-yl)propanoate is COC(=O)CCc1nc(Br)n[nH]1.
What is the InChIKey of methyl 3-(3-bromo-1H-1,2,4-triazol-5-yl)propanoate?
The InChIKey is GKKNFKKYCFGEAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8BrN3O2/c1-12-5(11)3-2-4-8-6(7)10-9-4/h2-3H2,1H3,(H,8,9,10).
What are the key properties of methyl 3-(3-bromo-1H-1,2,4-triazol-5-yl)propanoate?
methyl 3-(3-bromo-1H-1,2,4-triazol-5-yl)propanoate has a molecular weight of 234.05 g/mol, XLogP of 0.67, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(3-bromo-1H-1,2,4-triazol-5-yl)propanoate is sourced from PubChem (CID 52897321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).