C13H15ClN2OS2 — CID 5289896
1-(4-chlorophenyl)-N-(3,4,4-trimethyl-2-sulfanylidene-1,3-thiazolidin-5-yl)methanimine oxide (PubChem CID 5289896) has the molecular formula C13H15ClN2OS2 and a molecular weight of 314.86 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-N-(3,4,4-trimethyl-2-sulfanylidene-1,3-thiazolidin-5-yl)methanimine oxide.
| Compound Name | 1-(4-chlorophenyl)-N-(3,4,4-trimethyl-2-sulfanylidene-1,3-thiazolidin-5-yl)methanimine oxide |
|---|---|
| PubChem CID | 5289896 |
| Molecular Formula | C13H15ClN2OS2 |
| Molecular Weight | 314.86 g/mol |
| Exact Mass | 314.03 |
| IUPAC Name | 1-(4-chlorophenyl)-N-(3,4,4-trimethyl-2-sulfanylidene-1,3-thiazolidin-5-yl)methanimine oxide |
| SMILES | CN1C(=S)SC(/[N+]([O-])=C/c2ccc(Cl)cc2)C1(C)C |
| InChI | InChI=1S/C13H15ClN2OS2/c1-13(2)11(19-12(18)15(13)3)16(17)8-9-4-6-10(14)7-5-9/h4-8,11H,1-3H3/b16-8- |
| InChIKey | FOHOZHAJQRYSFG-PXNMLYILSA-N |
| XLogP | 3.34 |
| TPSA | 29.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.86 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|