C11H4ClF3N6S — CID 52899363
6-(6-chloroimidazo[1,2-a]pyridin-2-yl)-3-(trifluoromethyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole (PubChem CID 52899363) has the molecular formula C11H4ClF3N6S and a molecular weight of 344.71 g/mol. Its IUPAC name is 6-(6-chloroimidazo[1,2-a]pyridin-2-yl)-3-(trifluoromethyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole.
| Compound Name | 6-(6-chloroimidazo[1,2-a]pyridin-2-yl)-3-(trifluoromethyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
|---|---|
| PubChem CID | 52899363 |
| Molecular Formula | C11H4ClF3N6S |
| Molecular Weight | 344.71 g/mol |
| Exact Mass | 343.99 |
| IUPAC Name | 6-(6-chloroimidazo[1,2-a]pyridin-2-yl)-3-(trifluoromethyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
| SMILES | FC(F)(F)c1nnc2sc(-c3cn4cc(Cl)ccc4n3)nn12 |
| InChI | InChI=1S/C11H4ClF3N6S/c12-5-1-2-7-16-6(4-20(7)3-5)8-19-21-9(11(13,14)15)17-18-10(21)22-8/h1-4H |
| InChIKey | TVXLNQULAAFHFU-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 60.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.71 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |