C28H22N4O6 — CID 5289950
(4Z)-1-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-4-[hydroxy(phenyl)methylidene]-5-(4-nitrophenyl)pyrrolidine-2,3-dione (PubChem CID 5289950) has the molecular formula C28H22N4O6 and a molecular weight of 510.51 g/mol. Its IUPAC name is (4Z)-1-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-4-[hydroxy(phenyl)methylidene]-5-(4-nitrophenyl)pyrrolidine-2,3-dione.
| Compound Name | (4Z)-1-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-4-[hydroxy(phenyl)methylidene]-5-(4-nitrophenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 5289950 |
| Molecular Formula | C28H22N4O6 |
| Molecular Weight | 510.51 g/mol |
| Exact Mass | 510.15 |
| IUPAC Name | (4Z)-1-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-4-[hydroxy(phenyl)methylidene]-5-(4-nitrophenyl)pyrrolidine-2,3-dione |
| SMILES | Cc1c(N2C(=O)C(=O)/C(=C(\O)c3ccccc3)C2c2ccc([N+](=O)[O-])cc2)c(=O)n(-c2ccccc2)n1C |
| InChI | InChI=1S/C28H22N4O6/c1-17-23(27(35)31(29(17)2)20-11-7-4-8-12-20)30-24(18-13-15-21(16-14-18)32(37)38)22(26(34)28(30)36)25(33)19-9-5-3-6-10-19/h3-16,24,33H,1-2H3/b25-22- |
| InChIKey | MGDBJEXCXZZANA-LVWGJNHUSA-N |
| XLogP | 4.02 |
| TPSA | 127.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.51 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|