About N-(3-anilinopropyl)-N'-[4-(2-methyltetrazol-5-yl)phenyl]oxamide
N-(3-anilinopropyl)-N'-[4-(2-methyltetrazol-5-yl)phenyl]oxamide (PubChem CID 52899659) has the molecular formula C19H21N7O2
and a molecular weight of 379.42 g/mol. Its IUPAC name is N-(3-anilinopropyl)-N'-[4-(2-methyltetrazol-5-yl)phenyl]oxamide.
Molecular Properties
| Compound Name | N-(3-anilinopropyl)-N'-[4-(2-methyltetrazol-5-yl)phenyl]oxamide |
| PubChem CID | 52899659 |
| Molecular Formula | C19H21N7O2 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | N-(3-anilinopropyl)-N'-[4-(2-methyltetrazol-5-yl)phenyl]oxamide |
| SMILES | Cn1nnc(-c2ccc(NC(=O)C(=O)NCCCNc3ccccc3)cc2)n1 |
| InChI | InChI=1S/C19H21N7O2/c1-26-24-17(23-25-26)14-8-10-16(11-9-14)22-19(28)18(27)21-13-5-12-20-15-6-3-2-4-7-15/h2-4,6-11,20H,5,12-13H2,1H3,(H,21,27)(H,22,28) |
| InChIKey | ADLWKMDWJMSSNT-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 113.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N-(3-anilinopropyl)-N'-[4-(2-methyltetrazol-5-yl)phenyl]oxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-anilinopropyl)-N'-[4-(2-methyltetrazol-5-yl)phenyl]oxamide?
The IUPAC name of N-(3-anilinopropyl)-N'-[4-(2-methyltetrazol-5-yl)phenyl]oxamide (CID 52899659) is N-(3-anilinopropyl)-N'-[4-(2-methyltetrazol-5-yl)phenyl]oxamide.
What is the SMILES notation for N-(3-anilinopropyl)-N'-[4-(2-methyltetrazol-5-yl)phenyl]oxamide?
The canonical SMILES for N-(3-anilinopropyl)-N'-[4-(2-methyltetrazol-5-yl)phenyl]oxamide is Cn1nnc(-c2ccc(NC(=O)C(=O)NCCCNc3ccccc3)cc2)n1.
What is the InChIKey of N-(3-anilinopropyl)-N'-[4-(2-methyltetrazol-5-yl)phenyl]oxamide?
The InChIKey is ADLWKMDWJMSSNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21N7O2/c1-26-24-17(23-25-26)14-8-10-16(11-9-14)22-19(28)18(27)21-13-5-12-20-15-6-3-2-4-7-15/h2-4,6-11,20H,5,12-13H2,1H3,(H,21,27)(H,22,28).
What are the key properties of N-(3-anilinopropyl)-N'-[4-(2-methyltetrazol-5-yl)phenyl]oxamide?
N-(3-anilinopropyl)-N'-[4-(2-methyltetrazol-5-yl)phenyl]oxamide has a molecular weight of 379.42 g/mol, XLogP of 1.43, 7 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-anilinopropyl)-N'-[4-(2-methyltetrazol-5-yl)phenyl]oxamide is sourced from PubChem (CID 52899659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).