C19H15N3O3 — CID 52901119
(E)-2-cyano-N-(4-hydroxyphenyl)-3-(5-methoxy-1H-indol-3-yl)prop-2-enamide (PubChem CID 52901119) has the molecular formula C19H15N3O3 and a molecular weight of 333.35 g/mol. Its IUPAC name is (E)-2-cyano-N-(4-hydroxyphenyl)-3-(5-methoxy-1H-indol-3-yl)prop-2-enamide.
| Compound Name | (E)-2-cyano-N-(4-hydroxyphenyl)-3-(5-methoxy-1H-indol-3-yl)prop-2-enamide |
|---|---|
| PubChem CID | 52901119 |
| Molecular Formula | C19H15N3O3 |
| Molecular Weight | 333.35 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | (E)-2-cyano-N-(4-hydroxyphenyl)-3-(5-methoxy-1H-indol-3-yl)prop-2-enamide |
| SMILES | COc1ccc2[nH]cc(/C=C(\C#N)C(=O)Nc3ccc(O)cc3)c2c1 |
| InChI | InChI=1S/C19H15N3O3/c1-25-16-6-7-18-17(9-16)13(11-21-18)8-12(10-20)19(24)22-14-2-4-15(23)5-3-14/h2-9,11,21,23H,1H3,(H,22,24)/b12-8+ |
| InChIKey | ISWKEXMSYJEOGU-XYOKQWHBSA-N |
| XLogP | 3.43 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.35 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|