C22H26FN3O4 — CID 52903066
(2R)-4-(4-fluoroanilino)-2-[[4-(2-methoxyphenyl)piperazin-1-yl]methyl]-4-oxobutanoic acid (PubChem CID 52903066) has the molecular formula C22H26FN3O4 and a molecular weight of 415.47 g/mol. Its IUPAC name is (2R)-4-(4-fluoroanilino)-2-[[4-(2-methoxyphenyl)piperazin-1-yl]methyl]-4-oxobutanoic acid.
| Compound Name | (2R)-4-(4-fluoroanilino)-2-[[4-(2-methoxyphenyl)piperazin-1-yl]methyl]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 52903066 |
| Molecular Formula | C22H26FN3O4 |
| Molecular Weight | 415.47 g/mol |
| Exact Mass | 415.19 |
| IUPAC Name | (2R)-4-(4-fluoroanilino)-2-[[4-(2-methoxyphenyl)piperazin-1-yl]methyl]-4-oxobutanoic acid |
| SMILES | COc1ccccc1N1CCN(C[C@@H](CC(=O)Nc2ccc(F)cc2)C(=O)O)CC1 |
| InChI | InChI=1S/C22H26FN3O4/c1-30-20-5-3-2-4-19(20)26-12-10-25(11-13-26)15-16(22(28)29)14-21(27)24-18-8-6-17(23)7-9-18/h2-9,16H,10-15H2,1H3,(H,24,27)(H,28,29)/t16-/m1/s1 |
| InChIKey | GCYUDTLLNCZDHA-MRXNPFEDSA-N |
| XLogP | 2.69 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.47 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |