About 2-methyl-4,5,6,7-tetrahydroindazol-3-amine
2-methyl-4,5,6,7-tetrahydroindazol-3-amine (PubChem CID 52903608) has the molecular formula C8H13N3
and a molecular weight of 151.21 g/mol. Its IUPAC name is 2-methyl-4,5,6,7-tetrahydroindazol-3-amine.
Molecular Properties
| Compound Name | 2-methyl-4,5,6,7-tetrahydroindazol-3-amine |
| PubChem CID | 52903608 |
| Molecular Formula | C8H13N3 |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.11 |
| IUPAC Name | 2-methyl-4,5,6,7-tetrahydroindazol-3-amine |
| SMILES | Cn1nc2c(c1N)CCCC2 |
| InChI | InChI=1S/C8H13N3/c1-11-8(9)6-4-2-3-5-7(6)10-11/h2-5,9H2,1H3 |
| InChIKey | OOCMJNWYIMBFLU-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methyl-4,5,6,7-tetrahydroindazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-4,5,6,7-tetrahydroindazol-3-amine?
The IUPAC name of 2-methyl-4,5,6,7-tetrahydroindazol-3-amine (CID 52903608) is 2-methyl-4,5,6,7-tetrahydroindazol-3-amine.
What is the SMILES notation for 2-methyl-4,5,6,7-tetrahydroindazol-3-amine?
The canonical SMILES for 2-methyl-4,5,6,7-tetrahydroindazol-3-amine is Cn1nc2c(c1N)CCCC2.
What is the InChIKey of 2-methyl-4,5,6,7-tetrahydroindazol-3-amine?
The InChIKey is OOCMJNWYIMBFLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3/c1-11-8(9)6-4-2-3-5-7(6)10-11/h2-5,9H2,1H3.
What are the key properties of 2-methyl-4,5,6,7-tetrahydroindazol-3-amine?
2-methyl-4,5,6,7-tetrahydroindazol-3-amine has a molecular weight of 151.21 g/mol, XLogP of 0.88, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-4,5,6,7-tetrahydroindazol-3-amine is sourced from PubChem (CID 52903608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).