About 5-(3-methoxyphenyl)-7-(4-methylpiperidin-1-yl)-2-phenyl-[1,3]oxazolo[4,5-d]pyrimidine
5-(3-methoxyphenyl)-7-(4-methylpiperidin-1-yl)-2-phenyl-[1,3]oxazolo[4,5-d]pyrimidine (PubChem CID 52904755) has the molecular formula C24H24N4O2
and a molecular weight of 400.48 g/mol. Its IUPAC name is 5-(3-methoxyphenyl)-7-(4-methylpiperidin-1-yl)-2-phenyl-[1,3]oxazolo[4,5-d]pyrimidine.
Molecular Properties
| Compound Name | 5-(3-methoxyphenyl)-7-(4-methylpiperidin-1-yl)-2-phenyl-[1,3]oxazolo[4,5-d]pyrimidine |
| PubChem CID | 52904755 |
| Molecular Formula | C24H24N4O2 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | 5-(3-methoxyphenyl)-7-(4-methylpiperidin-1-yl)-2-phenyl-[1,3]oxazolo[4,5-d]pyrimidine |
| SMILES | COc1cccc(-c2nc(N3CCC(C)CC3)c3oc(-c4ccccc4)nc3n2)c1 |
| InChI | InChI=1S/C24H24N4O2/c1-16-11-13-28(14-12-16)23-20-22(27-24(30-20)17-7-4-3-5-8-17)25-21(26-23)18-9-6-10-19(15-18)29-2/h3-10,15-16H,11-14H2,1-2H3 |
| InChIKey | PWQVJOWVYHLDBT-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 64.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-(3-methoxyphenyl)-7-(4-methylpiperidin-1-yl)-2-phenyl-[1,3]oxazolo[4,5-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3-methoxyphenyl)-7-(4-methylpiperidin-1-yl)-2-phenyl-[1,3]oxazolo[4,5-d]pyrimidine?
The IUPAC name of 5-(3-methoxyphenyl)-7-(4-methylpiperidin-1-yl)-2-phenyl-[1,3]oxazolo[4,5-d]pyrimidine (CID 52904755) is 5-(3-methoxyphenyl)-7-(4-methylpiperidin-1-yl)-2-phenyl-[1,3]oxazolo[4,5-d]pyrimidine.
What is the SMILES notation for 5-(3-methoxyphenyl)-7-(4-methylpiperidin-1-yl)-2-phenyl-[1,3]oxazolo[4,5-d]pyrimidine?
The canonical SMILES for 5-(3-methoxyphenyl)-7-(4-methylpiperidin-1-yl)-2-phenyl-[1,3]oxazolo[4,5-d]pyrimidine is COc1cccc(-c2nc(N3CCC(C)CC3)c3oc(-c4ccccc4)nc3n2)c1.
What is the InChIKey of 5-(3-methoxyphenyl)-7-(4-methylpiperidin-1-yl)-2-phenyl-[1,3]oxazolo[4,5-d]pyrimidine?
The InChIKey is PWQVJOWVYHLDBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H24N4O2/c1-16-11-13-28(14-12-16)23-20-22(27-24(30-20)17-7-4-3-5-8-17)25-21(26-23)18-9-6-10-19(15-18)29-2/h3-10,15-16H,11-14H2,1-2H3.
What are the key properties of 5-(3-methoxyphenyl)-7-(4-methylpiperidin-1-yl)-2-phenyl-[1,3]oxazolo[4,5-d]pyrimidine?
5-(3-methoxyphenyl)-7-(4-methylpiperidin-1-yl)-2-phenyl-[1,3]oxazolo[4,5-d]pyrimidine has a molecular weight of 400.48 g/mol, XLogP of 5.20, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3-methoxyphenyl)-7-(4-methylpiperidin-1-yl)-2-phenyl-[1,3]oxazolo[4,5-d]pyrimidine is sourced from PubChem (CID 52904755), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).