C17H16N2O3 — CID 52905152
(2'R,3S)-2'-(3,4-dihydroxyphenyl)spiro[1H-indole-3,3'-pyrrolidine]-2-one (PubChem CID 52905152) has the molecular formula C17H16N2O3 and a molecular weight of 296.33 g/mol. Its IUPAC name is (2'R,3S)-2'-(3,4-dihydroxyphenyl)spiro[1H-indole-3,3'-pyrrolidine]-2-one.
| Compound Name | (2'R,3S)-2'-(3,4-dihydroxyphenyl)spiro[1H-indole-3,3'-pyrrolidine]-2-one |
|---|---|
| PubChem CID | 52905152 |
| Molecular Formula | C17H16N2O3 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | (2'R,3S)-2'-(3,4-dihydroxyphenyl)spiro[1H-indole-3,3'-pyrrolidine]-2-one |
| SMILES | O=C1Nc2ccccc2[C@]12CCN[C@@H]2c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C17H16N2O3/c20-13-6-5-10(9-14(13)21)15-17(7-8-18-15)11-3-1-2-4-12(11)19-16(17)22/h1-6,9,15,18,20-21H,7-8H2,(H,19,22)/t15-,17+/m1/s1 |
| InChIKey | GYQMBGLYRVEOLL-WBVHZDCISA-N |
| XLogP | 2.02 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|