About 4,6-dimethyl-2-propan-2-yl-1,3,5-dithiazinane
4,6-dimethyl-2-propan-2-yl-1,3,5-dithiazinane (PubChem CID 529055) has the molecular formula C8H17NS2
and a molecular weight of 191.36 g/mol. Its IUPAC name is 4,6-dimethyl-2-propan-2-yl-1,3,5-dithiazinane.
Molecular Properties
| Compound Name | 4,6-dimethyl-2-propan-2-yl-1,3,5-dithiazinane |
| PubChem CID | 529055 |
| Molecular Formula | C8H17NS2 |
| Molecular Weight | 191.36 g/mol |
| Exact Mass | 191.08 |
| IUPAC Name | 4,6-dimethyl-2-propan-2-yl-1,3,5-dithiazinane |
| SMILES | CC1NC(C)SC(C(C)C)S1 |
| InChI | InChI=1S/C8H17NS2/c1-5(2)8-10-6(3)9-7(4)11-8/h5-9H,1-4H3 |
| InChIKey | ZNOHVVXGIQIPAU-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.36 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4,6-dimethyl-2-propan-2-yl-1,3,5-dithiazinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-dimethyl-2-propan-2-yl-1,3,5-dithiazinane?
The IUPAC name of 4,6-dimethyl-2-propan-2-yl-1,3,5-dithiazinane (CID 529055) is 4,6-dimethyl-2-propan-2-yl-1,3,5-dithiazinane.
What is the SMILES notation for 4,6-dimethyl-2-propan-2-yl-1,3,5-dithiazinane?
The canonical SMILES for 4,6-dimethyl-2-propan-2-yl-1,3,5-dithiazinane is CC1NC(C)SC(C(C)C)S1.
What is the InChIKey of 4,6-dimethyl-2-propan-2-yl-1,3,5-dithiazinane?
The InChIKey is ZNOHVVXGIQIPAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NS2/c1-5(2)8-10-6(3)9-7(4)11-8/h5-9H,1-4H3.
What are the key properties of 4,6-dimethyl-2-propan-2-yl-1,3,5-dithiazinane?
4,6-dimethyl-2-propan-2-yl-1,3,5-dithiazinane has a molecular weight of 191.36 g/mol, XLogP of 2.73, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-dimethyl-2-propan-2-yl-1,3,5-dithiazinane is sourced from PubChem (CID 529055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).