C11H17N3O — CID 52906688
1-[4-(pyrazol-1-ylmethyl)piperidin-1-yl]ethanone (PubChem CID 52906688) has the molecular formula C11H17N3O and a molecular weight of 207.28 g/mol. Its IUPAC name is 1-[4-(pyrazol-1-ylmethyl)piperidin-1-yl]ethanone.
| Compound Name | 1-[4-(pyrazol-1-ylmethyl)piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 52906688 |
| Molecular Formula | C11H17N3O |
| Molecular Weight | 207.28 g/mol |
| Exact Mass | 207.14 |
| IUPAC Name | 1-[4-(pyrazol-1-ylmethyl)piperidin-1-yl]ethanone |
| SMILES | CC(=O)N1CCC(Cn2cccn2)CC1 |
| InChI | InChI=1S/C11H17N3O/c1-10(15)13-7-3-11(4-8-13)9-14-6-2-5-12-14/h2,5-6,11H,3-4,7-9H2,1H3 |
| InChIKey | VPZZEJKKXSCYDQ-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.28 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |