C26H29N3O4 — CID 5290691
ethyl 4-[2,5-dioxo-3-[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]pyrrolidin-1-yl]benzoate (PubChem CID 5290691) has the molecular formula C26H29N3O4 and a molecular weight of 447.54 g/mol. Its IUPAC name is ethyl 4-[2,5-dioxo-3-[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]pyrrolidin-1-yl]benzoate.
| Compound Name | ethyl 4-[2,5-dioxo-3-[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]pyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 5290691 |
| Molecular Formula | C26H29N3O4 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.22 |
| IUPAC Name | ethyl 4-[2,5-dioxo-3-[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]pyrrolidin-1-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2C(=O)CC(N3CCN(C/C=C/c4ccccc4)CC3)C2=O)cc1 |
| InChI | InChI=1S/C26H29N3O4/c1-2-33-26(32)21-10-12-22(13-11-21)29-24(30)19-23(25(29)31)28-17-15-27(16-18-28)14-6-9-20-7-4-3-5-8-20/h3-13,23H,2,14-19H2,1H3/b9-6+ |
| InChIKey | JGSSJLAZAZTHQB-RMKNXTFCSA-N |
| XLogP | 2.83 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|