C16H15N3O2 — CID 52907271
(2S)-N-(5-methyl-1,2-oxazol-3-yl)-2-phenyl-2-pyrrol-1-ylacetamide (PubChem CID 52907271) has the molecular formula C16H15N3O2 and a molecular weight of 281.32 g/mol. Its IUPAC name is (2S)-N-(5-methyl-1,2-oxazol-3-yl)-2-phenyl-2-pyrrol-1-ylacetamide.
| Compound Name | (2S)-N-(5-methyl-1,2-oxazol-3-yl)-2-phenyl-2-pyrrol-1-ylacetamide |
|---|---|
| PubChem CID | 52907271 |
| Molecular Formula | C16H15N3O2 |
| Molecular Weight | 281.32 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | (2S)-N-(5-methyl-1,2-oxazol-3-yl)-2-phenyl-2-pyrrol-1-ylacetamide |
| SMILES | Cc1cc(NC(=O)[C@H](c2ccccc2)n2cccc2)no1 |
| InChI | InChI=1S/C16H15N3O2/c1-12-11-14(18-21-12)17-16(20)15(19-9-5-6-10-19)13-7-3-2-4-8-13/h2-11,15H,1H3,(H,17,18,20)/t15-/m0/s1 |
| InChIKey | IVXCUHPTFJSCLI-HNNXBMFYSA-N |
| XLogP | 3.01 |
| TPSA | 60.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.32 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |