About cyclobutyl-[4-[2-(3,5-dimethylpyrazol-1-yl)ethyl]piperazin-1-yl]methanone
cyclobutyl-[4-[2-(3,5-dimethylpyrazol-1-yl)ethyl]piperazin-1-yl]methanone (PubChem CID 52907393) has the molecular formula C16H26N4O
and a molecular weight of 290.41 g/mol. Its IUPAC name is cyclobutyl-[4-[2-(3,5-dimethylpyrazol-1-yl)ethyl]piperazin-1-yl]methanone.
Molecular Properties
| Compound Name | cyclobutyl-[4-[2-(3,5-dimethylpyrazol-1-yl)ethyl]piperazin-1-yl]methanone |
| PubChem CID | 52907393 |
| Molecular Formula | C16H26N4O |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.21 |
| IUPAC Name | cyclobutyl-[4-[2-(3,5-dimethylpyrazol-1-yl)ethyl]piperazin-1-yl]methanone |
| SMILES | Cc1cc(C)n(CCN2CCN(C(=O)C3CCC3)CC2)n1 |
| InChI | InChI=1S/C16H26N4O/c1-13-12-14(2)20(17-13)11-8-18-6-9-19(10-7-18)16(21)15-4-3-5-15/h12,15H,3-11H2,1-2H3 |
| InChIKey | VSQLURUFILGACJ-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze cyclobutyl-[4-[2-(3,5-dimethylpyrazol-1-yl)ethyl]piperazin-1-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclobutyl-[4-[2-(3,5-dimethylpyrazol-1-yl)ethyl]piperazin-1-yl]methanone?
The IUPAC name of cyclobutyl-[4-[2-(3,5-dimethylpyrazol-1-yl)ethyl]piperazin-1-yl]methanone (CID 52907393) is cyclobutyl-[4-[2-(3,5-dimethylpyrazol-1-yl)ethyl]piperazin-1-yl]methanone.
What is the SMILES notation for cyclobutyl-[4-[2-(3,5-dimethylpyrazol-1-yl)ethyl]piperazin-1-yl]methanone?
The canonical SMILES for cyclobutyl-[4-[2-(3,5-dimethylpyrazol-1-yl)ethyl]piperazin-1-yl]methanone is Cc1cc(C)n(CCN2CCN(C(=O)C3CCC3)CC2)n1.
What is the InChIKey of cyclobutyl-[4-[2-(3,5-dimethylpyrazol-1-yl)ethyl]piperazin-1-yl]methanone?
The InChIKey is VSQLURUFILGACJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26N4O/c1-13-12-14(2)20(17-13)11-8-18-6-9-19(10-7-18)16(21)15-4-3-5-15/h12,15H,3-11H2,1-2H3.
What are the key properties of cyclobutyl-[4-[2-(3,5-dimethylpyrazol-1-yl)ethyl]piperazin-1-yl]methanone?
cyclobutyl-[4-[2-(3,5-dimethylpyrazol-1-yl)ethyl]piperazin-1-yl]methanone has a molecular weight of 290.41 g/mol, XLogP of 1.44, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cyclobutyl-[4-[2-(3,5-dimethylpyrazol-1-yl)ethyl]piperazin-1-yl]methanone is sourced from PubChem (CID 52907393), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).