C6H12OS — CID 529078
2,5-dimethyl-1,3-oxathiane (PubChem CID 529078) has the molecular formula C6H12OS and a molecular weight of 132.23 g/mol. Its IUPAC name is 2,5-dimethyl-1,3-oxathiane.
| Compound Name | 2,5-dimethyl-1,3-oxathiane |
|---|---|
| PubChem CID | 529078 |
| Molecular Formula | C6H12OS |
| Molecular Weight | 132.23 g/mol |
| Exact Mass | 132.06 |
| IUPAC Name | 2,5-dimethyl-1,3-oxathiane |
| SMILES | CC1COC(C)SC1 |
| InChI | InChI=1S/C6H12OS/c1-5-3-7-6(2)8-4-5/h5-6H,3-4H2,1-2H3 |
| InChIKey | ZDXSSYRUPOPWQI-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.23 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |