C19H16F4O2 — CID 5290862
(E)-6,6,7,7-tetrafluoro-5-hydroxy-1,5-diphenylhept-1-en-3-one (PubChem CID 5290862) has the molecular formula C19H16F4O2 and a molecular weight of 352.33 g/mol. Its IUPAC name is (E)-6,6,7,7-tetrafluoro-5-hydroxy-1,5-diphenylhept-1-en-3-one.
| Compound Name | (E)-6,6,7,7-tetrafluoro-5-hydroxy-1,5-diphenylhept-1-en-3-one |
|---|---|
| PubChem CID | 5290862 |
| Molecular Formula | C19H16F4O2 |
| Molecular Weight | 352.33 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | (E)-6,6,7,7-tetrafluoro-5-hydroxy-1,5-diphenylhept-1-en-3-one |
| SMILES | O=C(/C=C/c1ccccc1)CC(O)(c1ccccc1)C(F)(F)C(F)F |
| InChI | InChI=1S/C19H16F4O2/c20-17(21)19(22,23)18(25,15-9-5-2-6-10-15)13-16(24)12-11-14-7-3-1-4-8-14/h1-12,17,25H,13H2/b12-11+ |
| InChIKey | LRSCXAZTJXRCCO-VAWYXSNFSA-N |
| XLogP | 4.45 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.33 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|