C24H25N3O5S2 — CID 52908647
2-[2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl(methyl)amino]-N-[(7R)-2-phenyl-4,5,6,7-tetrahydro-1,3-benzothiazol-7-yl]acetamide (PubChem CID 52908647) has the molecular formula C24H25N3O5S2 and a molecular weight of 499.61 g/mol. Its IUPAC name is 2-[2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl(methyl)amino]-N-[(7R)-2-phenyl-4,5,6,7-tetrahydro-1,3-benzothiazol-7-yl]acetamide.
| Compound Name | 2-[2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl(methyl)amino]-N-[(7R)-2-phenyl-4,5,6,7-tetrahydro-1,3-benzothiazol-7-yl]acetamide |
|---|---|
| PubChem CID | 52908647 |
| Molecular Formula | C24H25N3O5S2 |
| Molecular Weight | 499.61 g/mol |
| Exact Mass | 499.12 |
| IUPAC Name | 2-[2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl(methyl)amino]-N-[(7R)-2-phenyl-4,5,6,7-tetrahydro-1,3-benzothiazol-7-yl]acetamide |
| SMILES | CN(CC(=O)N[C@@H]1CCCc2nc(-c3ccccc3)sc21)S(=O)(=O)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C24H25N3O5S2/c1-27(34(29,30)17-10-11-20-21(14-17)32-13-12-31-20)15-22(28)25-18-8-5-9-19-23(18)33-24(26-19)16-6-3-2-4-7-16/h2-4,6-7,10-11,14,18H,5,8-9,12-13,15H2,1H3,(H,25,28)/t18-/m1/s1 |
| InChIKey | OCUOKRXGEMPAJW-GOSISDBHSA-N |
| XLogP | 3.40 |
| TPSA | 97.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.61 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |