About 3-methyl-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-4-one
3-methyl-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-4-one (PubChem CID 529096) has the molecular formula C9H12N2O
and a molecular weight of 164.21 g/mol. Its IUPAC name is 3-methyl-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-4-one.
Analyze 3-methyl-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-4-one?
The IUPAC name of 3-methyl-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-4-one (CID 529096) is 3-methyl-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-4-one.
What is the SMILES notation for 3-methyl-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-4-one?
The canonical SMILES for 3-methyl-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-4-one is Cc1cnc2n(c1=O)CCCC2.
What is the InChIKey of 3-methyl-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-4-one?
The InChIKey is BZOPBXXGKITYKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O/c1-7-6-10-8-4-2-3-5-11(8)9(7)12/h6H,2-5H2,1H3.
What are the key properties of 3-methyl-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-4-one?
3-methyl-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-4-one has a molecular weight of 164.21 g/mol, XLogP of 0.89, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-4-one is sourced from PubChem (CID 529096), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).