C18H21N3O2S — CID 52910253
cyclopropyl-[4-[1-(thiophen-2-ylmethyl)pyrrole-2-carbonyl]piperazin-1-yl]methanone (PubChem CID 52910253) has the molecular formula C18H21N3O2S and a molecular weight of 343.45 g/mol. Its IUPAC name is cyclopropyl-[4-[1-(thiophen-2-ylmethyl)pyrrole-2-carbonyl]piperazin-1-yl]methanone.
| Compound Name | cyclopropyl-[4-[1-(thiophen-2-ylmethyl)pyrrole-2-carbonyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 52910253 |
| Molecular Formula | C18H21N3O2S |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | cyclopropyl-[4-[1-(thiophen-2-ylmethyl)pyrrole-2-carbonyl]piperazin-1-yl]methanone |
| SMILES | O=C(c1cccn1Cc1cccs1)N1CCN(C(=O)C2CC2)CC1 |
| InChI | InChI=1S/C18H21N3O2S/c22-17(14-5-6-14)19-8-10-20(11-9-19)18(23)16-4-1-7-21(16)13-15-3-2-12-24-15/h1-4,7,12,14H,5-6,8-11,13H2 |
| InChIKey | RMZUOTXWSMBCMW-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 45.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |