C21H20O — CID 5291033
(2E,5E)-2,5-bis[(4-methylphenyl)methylidene]cyclopentan-1-one (PubChem CID 5291033) has the molecular formula C21H20O and a molecular weight of 288.39 g/mol. Its IUPAC name is (2E,5E)-2,5-bis[(4-methylphenyl)methylidene]cyclopentan-1-one.
| Compound Name | (2E,5E)-2,5-bis[(4-methylphenyl)methylidene]cyclopentan-1-one |
|---|---|
| PubChem CID | 5291033 |
| Molecular Formula | C21H20O |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | (2E,5E)-2,5-bis[(4-methylphenyl)methylidene]cyclopentan-1-one |
| SMILES | Cc1ccc(/C=C2\CC/C(=C\c3ccc(C)cc3)C2=O)cc1 |
| InChI | InChI=1S/C21H20O/c1-15-3-7-17(8-4-15)13-19-11-12-20(21(19)22)14-18-9-5-16(2)6-10-18/h3-10,13-14H,11-12H2,1-2H3/b19-13+,20-14+ |
| InChIKey | IXIITVGWLWCRQL-IWGRKNQJSA-N |
| XLogP | 5.13 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|