About 1-methylazepan-4-amine
1-methylazepan-4-amine (PubChem CID 52911273) has the molecular formula C7H16N2
and a molecular weight of 128.22 g/mol. Its IUPAC name is 1-methylazepan-4-amine.
Molecular Properties
| Compound Name | 1-methylazepan-4-amine |
| PubChem CID | 52911273 |
| Molecular Formula | C7H16N2 |
| Molecular Weight | 128.22 g/mol |
| Exact Mass | 128.13 |
| IUPAC Name | 1-methylazepan-4-amine |
| SMILES | CN1CCCC(N)CC1 |
| InChI | InChI=1S/C7H16N2/c1-9-5-2-3-7(8)4-6-9/h7H,2-6,8H2,1H3 |
| InChIKey | LYRZFDLVKYYDOX-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.22 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-methylazepan-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylazepan-4-amine?
The IUPAC name of 1-methylazepan-4-amine (CID 52911273) is 1-methylazepan-4-amine.
What is the SMILES notation for 1-methylazepan-4-amine?
The canonical SMILES for 1-methylazepan-4-amine is CN1CCCC(N)CC1.
What is the InChIKey of 1-methylazepan-4-amine?
The InChIKey is LYRZFDLVKYYDOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16N2/c1-9-5-2-3-7(8)4-6-9/h7H,2-6,8H2,1H3.
What are the key properties of 1-methylazepan-4-amine?
1-methylazepan-4-amine has a molecular weight of 128.22 g/mol, XLogP of 0.43, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylazepan-4-amine is sourced from PubChem (CID 52911273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).