About 1-[1-(3-bromo-4-fluorophenyl)benzimidazol-5-yl]-2,2,2-trideuterioethanone
1-[1-(3-bromo-4-fluorophenyl)benzimidazol-5-yl]-2,2,2-trideuterioethanone (PubChem CID 52911485) has the molecular formula C15H10BrFN2O
and a molecular weight of 336.18 g/mol. Its IUPAC name is 1-[1-(3-bromo-4-fluorophenyl)benzimidazol-5-yl]-2,2,2-trideuterioethanone.
Molecular Properties
| Compound Name | 1-[1-(3-bromo-4-fluorophenyl)benzimidazol-5-yl]-2,2,2-trideuterioethanone |
| PubChem CID | 52911485 |
| Molecular Formula | C15H10BrFN2O |
| Molecular Weight | 336.18 g/mol |
| Exact Mass | 335.01 |
| IUPAC Name | 1-[1-(3-bromo-4-fluorophenyl)benzimidazol-5-yl]-2,2,2-trideuterioethanone |
| SMILES | [2H]C([2H])([2H])C(=O)c1ccc2c(c1)ncn2-c1ccc(F)c(Br)c1 |
| InChI | InChI=1S/C15H10BrFN2O/c1-9(20)10-2-5-15-14(6-10)18-8-19(15)11-3-4-13(17)12(16)7-11/h2-8H,1H3/i1D3 |
| InChIKey | JMPMWYIQLRKJBG-FIBGUPNXSA-N |
| XLogP | 4.13 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.18 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[1-(3-bromo-4-fluorophenyl)benzimidazol-5-yl]-2,2,2-trideuterioethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-(3-bromo-4-fluorophenyl)benzimidazol-5-yl]-2,2,2-trideuterioethanone?
The IUPAC name of 1-[1-(3-bromo-4-fluorophenyl)benzimidazol-5-yl]-2,2,2-trideuterioethanone (CID 52911485) is 1-[1-(3-bromo-4-fluorophenyl)benzimidazol-5-yl]-2,2,2-trideuterioethanone.
What is the SMILES notation for 1-[1-(3-bromo-4-fluorophenyl)benzimidazol-5-yl]-2,2,2-trideuterioethanone?
The canonical SMILES for 1-[1-(3-bromo-4-fluorophenyl)benzimidazol-5-yl]-2,2,2-trideuterioethanone is [2H]C([2H])([2H])C(=O)c1ccc2c(c1)ncn2-c1ccc(F)c(Br)c1.
What is the InChIKey of 1-[1-(3-bromo-4-fluorophenyl)benzimidazol-5-yl]-2,2,2-trideuterioethanone?
The InChIKey is JMPMWYIQLRKJBG-FIBGUPNXSA-N. The full InChI is InChI=1S/C15H10BrFN2O/c1-9(20)10-2-5-15-14(6-10)18-8-19(15)11-3-4-13(17)12(16)7-11/h2-8H,1H3/i1D3.
What are the key properties of 1-[1-(3-bromo-4-fluorophenyl)benzimidazol-5-yl]-2,2,2-trideuterioethanone?
1-[1-(3-bromo-4-fluorophenyl)benzimidazol-5-yl]-2,2,2-trideuterioethanone has a molecular weight of 336.18 g/mol, XLogP of 4.13, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-(3-bromo-4-fluorophenyl)benzimidazol-5-yl]-2,2,2-trideuterioethanone is sourced from PubChem (CID 52911485), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).