C16H20F3NO — CID 52911608
(4aR,8aR)-4-(2,3,5-trifluoroanilino)-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-4a-ol (PubChem CID 52911608) has the molecular formula C16H20F3NO and a molecular weight of 299.34 g/mol. Its IUPAC name is (4aR,8aR)-4-(2,3,5-trifluoroanilino)-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-4a-ol.
| Compound Name | (4aR,8aR)-4-(2,3,5-trifluoroanilino)-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-4a-ol |
|---|---|
| PubChem CID | 52911608 |
| Molecular Formula | C16H20F3NO |
| Molecular Weight | 299.34 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | (4aR,8aR)-4-(2,3,5-trifluoroanilino)-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-4a-ol |
| SMILES | O[C@]12CCCC[C@@H]1CCCC2Nc1cc(F)cc(F)c1F |
| InChI | InChI=1S/C16H20F3NO/c17-11-8-12(18)15(19)13(9-11)20-14-6-3-5-10-4-1-2-7-16(10,14)21/h8-10,14,20-21H,1-7H2/t10-,14?,16-/m1/s1 |
| InChIKey | GPCNCONAXUITRY-FGOGKNADSA-N |
| XLogP | 3.99 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.34 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|