C14H13Cl2F5N4O2S — CID 52911734
4-(2-chloro-2,2-difluoroethyl)-1-[[6-chloro-2-(2,2,2-trifluoroethoxymethyl)imidazo[2,1-b][1,3,4]thiadiazol-5-yl]methyl]pyrrolidin-2-one (PubChem CID 52911734) has the molecular formula C14H13Cl2F5N4O2S and a molecular weight of 467.25 g/mol. Its IUPAC name is 4-(2-chloro-2,2-difluoroethyl)-1-[[6-chloro-2-(2,2,2-trifluoroethoxymethyl)imidazo[2,1-b][1,3,4]thiadiazol-5-yl]methyl]pyrrolidin-2-one.
| Compound Name | 4-(2-chloro-2,2-difluoroethyl)-1-[[6-chloro-2-(2,2,2-trifluoroethoxymethyl)imidazo[2,1-b][1,3,4]thiadiazol-5-yl]methyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 52911734 |
| Molecular Formula | C14H13Cl2F5N4O2S |
| Molecular Weight | 467.25 g/mol |
| Exact Mass | 466.01 |
| IUPAC Name | 4-(2-chloro-2,2-difluoroethyl)-1-[[6-chloro-2-(2,2,2-trifluoroethoxymethyl)imidazo[2,1-b][1,3,4]thiadiazol-5-yl]methyl]pyrrolidin-2-one |
| SMILES | O=C1CC(CC(F)(F)Cl)CN1Cc1c(Cl)nc2sc(COCC(F)(F)F)nn12 |
| InChI | InChI=1S/C14H13Cl2F5N4O2S/c15-11-8(4-24-3-7(1-10(24)26)2-13(16,17)18)25-12(22-11)28-9(23-25)5-27-6-14(19,20)21/h7H,1-6H2 |
| InChIKey | YXOAMRMNLMTAGB-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 59.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.25 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|