C16H18N6O3S — CID 52911804
N,N-dimethyl-4-[5-[2-(2-methyl-5-nitroimidazol-1-yl)ethylsulfanyl]-1,3,4-oxadiazol-2-yl]aniline (PubChem CID 52911804) has the molecular formula C16H18N6O3S and a molecular weight of 374.43 g/mol. Its IUPAC name is N,N-dimethyl-4-[5-[2-(2-methyl-5-nitroimidazol-1-yl)ethylsulfanyl]-1,3,4-oxadiazol-2-yl]aniline.
| Compound Name | N,N-dimethyl-4-[5-[2-(2-methyl-5-nitroimidazol-1-yl)ethylsulfanyl]-1,3,4-oxadiazol-2-yl]aniline |
|---|---|
| PubChem CID | 52911804 |
| Molecular Formula | C16H18N6O3S |
| Molecular Weight | 374.43 g/mol |
| Exact Mass | 374.12 |
| IUPAC Name | N,N-dimethyl-4-[5-[2-(2-methyl-5-nitroimidazol-1-yl)ethylsulfanyl]-1,3,4-oxadiazol-2-yl]aniline |
| SMILES | Cc1ncc([N+](=O)[O-])n1CCSc1nnc(-c2ccc(N(C)C)cc2)o1 |
| InChI | InChI=1S/C16H18N6O3S/c1-11-17-10-14(22(23)24)21(11)8-9-26-16-19-18-15(25-16)12-4-6-13(7-5-12)20(2)3/h4-7,10H,8-9H2,1-3H3 |
| InChIKey | SKTSQEUSYVNDLS-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 103.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.43 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|