C18H22ClN7O2 — CID 52911960
1-(2-chloro-6-methoxy-4-pyridinyl)-3-[(1,3-dimethyl-7-propan-2-ylpyrazolo[4,5-b]pyridin-5-yl)amino]urea (PubChem CID 52911960) has the molecular formula C18H22ClN7O2 and a molecular weight of 403.87 g/mol. Its IUPAC name is 1-(2-chloro-6-methoxy-4-pyridinyl)-3-[(1,3-dimethyl-7-propan-2-ylpyrazolo[4,5-b]pyridin-5-yl)amino]urea.
| Compound Name | 1-(2-chloro-6-methoxy-4-pyridinyl)-3-[(1,3-dimethyl-7-propan-2-ylpyrazolo[4,5-b]pyridin-5-yl)amino]urea |
|---|---|
| PubChem CID | 52911960 |
| Molecular Formula | C18H22ClN7O2 |
| Molecular Weight | 403.87 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | 1-(2-chloro-6-methoxy-4-pyridinyl)-3-[(1,3-dimethyl-7-propan-2-ylpyrazolo[4,5-b]pyridin-5-yl)amino]urea |
| SMILES | COc1cc(NC(=O)NNc2cc(C(C)C)c3c(n2)c(C)nn3C)cc(Cl)n1 |
| InChI | InChI=1S/C18H22ClN7O2/c1-9(2)12-8-14(22-16-10(3)25-26(4)17(12)16)23-24-18(27)20-11-6-13(19)21-15(7-11)28-5/h6-9H,1-5H3,(H,22,23)(H2,20,21,24,27) |
| InChIKey | IXFDGMQGOUCXMF-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 105.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.87 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|